C8H12O5S — CID 54269499
[(2S,5R)-5-acetyloxy-1,3-oxathiolan-2-yl]methyl acetate (PubChem CID 54269499) has the molecular formula C8H12O5S and a molecular weight of 220.25 g/mol. Its IUPAC name is [(2S,5R)-5-acetyloxy-1,3-oxathiolan-2-yl]methyl acetate.
| Compound Name | [(2S,5R)-5-acetyloxy-1,3-oxathiolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 54269499 |
| Molecular Formula | C8H12O5S |
| Molecular Weight | 220.25 g/mol |
| Exact Mass | 220.04 |
| IUPAC Name | [(2S,5R)-5-acetyloxy-1,3-oxathiolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](OC(C)=O)CS1 |
| InChI | InChI=1S/C8H12O5S/c1-5(9)11-3-8-13-7(4-14-8)12-6(2)10/h7-8H,3-4H2,1-2H3/t7-,8+/m1/s1 |
| InChIKey | RJDQNCIJIBLJIS-SFYZADRCSA-N |
| XLogP | 0.53 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.25 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |