C10H16O5S — CID 11118412
[(2S)-5-acetyloxy-1,3-oxathiolan-2-yl]methyl butanoate (PubChem CID 11118412) has the molecular formula C10H16O5S and a molecular weight of 248.30 g/mol. Its IUPAC name is [(2S)-5-acetyloxy-1,3-oxathiolan-2-yl]methyl butanoate.
| Compound Name | [(2S)-5-acetyloxy-1,3-oxathiolan-2-yl]methyl butanoate |
|---|---|
| PubChem CID | 11118412 |
| Molecular Formula | C10H16O5S |
| Molecular Weight | 248.30 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | [(2S)-5-acetyloxy-1,3-oxathiolan-2-yl]methyl butanoate |
| SMILES | CCCC(=O)OC[C@H]1OC(OC(C)=O)CS1 |
| InChI | InChI=1S/C10H16O5S/c1-3-4-8(12)13-5-10-15-9(6-16-10)14-7(2)11/h9-10H,3-6H2,1-2H3/t9?,10-/m0/s1 |
| InChIKey | ZRDBSYAWEPHALC-AXDSSHIGSA-N |
| XLogP | 1.31 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.30 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |