C10H16O5S — CID 141072389
[2-[(2-methyl-1-oxopropan-2-yl)oxymethyl]-1,3-oxathiolan-5-yl] acetate (PubChem CID 141072389) has the molecular formula C10H16O5S and a molecular weight of 248.30 g/mol. Its IUPAC name is [2-[(2-methyl-1-oxopropan-2-yl)oxymethyl]-1,3-oxathiolan-5-yl] acetate.
| Compound Name | [2-[(2-methyl-1-oxopropan-2-yl)oxymethyl]-1,3-oxathiolan-5-yl] acetate |
|---|---|
| PubChem CID | 141072389 |
| Molecular Formula | C10H16O5S |
| Molecular Weight | 248.30 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | [2-[(2-methyl-1-oxopropan-2-yl)oxymethyl]-1,3-oxathiolan-5-yl] acetate |
| SMILES | CC(=O)OC1CSC(COC(C)(C)C=O)O1 |
| InChI | InChI=1S/C10H16O5S/c1-7(12)14-8-5-16-9(15-8)4-13-10(2,3)6-11/h6,8-9H,4-5H2,1-3H3 |
| InChIKey | FHXOWELAKUKWEG-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.30 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|