C16H16O5S — CID 121280660
1-(5-acetyloxy-1,3-oxathiolan-2-yl)but-2-ynyl benzoate (PubChem CID 121280660) has the molecular formula C16H16O5S and a molecular weight of 320.37 g/mol. Its IUPAC name is 1-(5-acetyloxy-1,3-oxathiolan-2-yl)but-2-ynyl benzoate.
| Compound Name | 1-(5-acetyloxy-1,3-oxathiolan-2-yl)but-2-ynyl benzoate |
|---|---|
| PubChem CID | 121280660 |
| Molecular Formula | C16H16O5S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | 1-(5-acetyloxy-1,3-oxathiolan-2-yl)but-2-ynyl benzoate |
| SMILES | CC#CC(OC(=O)c1ccccc1)C1OC(OC(C)=O)CS1 |
| InChI | InChI=1S/C16H16O5S/c1-3-7-13(16-21-14(10-22-16)19-11(2)17)20-15(18)12-8-5-4-6-9-12/h4-6,8-9,13-14,16H,10H2,1-2H3 |
| InChIKey | WAYASUXATZZBGJ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|