C16H17BrO6S — CID 54067736
[(3R,4S,5R)-4,5-diacetyloxy-6-bromothian-3-yl] benzoate (PubChem CID 54067736) has the molecular formula C16H17BrO6S and a molecular weight of 417.28 g/mol. Its IUPAC name is [(3R,4S,5R)-4,5-diacetyloxy-6-bromothian-3-yl] benzoate.
| Compound Name | [(3R,4S,5R)-4,5-diacetyloxy-6-bromothian-3-yl] benzoate |
|---|---|
| PubChem CID | 54067736 |
| Molecular Formula | C16H17BrO6S |
| Molecular Weight | 417.28 g/mol |
| Exact Mass | 415.99 |
| IUPAC Name | [(3R,4S,5R)-4,5-diacetyloxy-6-bromothian-3-yl] benzoate |
| SMILES | CC(=O)O[C@H]1[C@@H](OC(=O)c2ccccc2)CSC(Br)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C16H17BrO6S/c1-9(18)21-13-12(8-24-15(17)14(13)22-10(2)19)23-16(20)11-6-4-3-5-7-11/h3-7,12-15H,8H2,1-2H3/t12-,13-,14+,15?/m0/s1 |
| InChIKey | MEFLLOSZDYVLAF-RDGKXADDSA-N |
| XLogP | 2.54 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.28 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|