C11H14ClNO2S — CID 52993866
[(3R,4S)-4-aminothiolan-3-yl] benzoate;hydrochloride (PubChem CID 52993866) has the molecular formula C11H14ClNO2S and a molecular weight of 259.76 g/mol. Its IUPAC name is [(3R,4S)-4-aminothiolan-3-yl] benzoate;hydrochloride.
| Compound Name | [(3R,4S)-4-aminothiolan-3-yl] benzoate;hydrochloride |
|---|---|
| PubChem CID | 52993866 |
| Molecular Formula | C11H14ClNO2S |
| Molecular Weight | 259.76 g/mol |
| Exact Mass | 259.04 |
| IUPAC Name | [(3R,4S)-4-aminothiolan-3-yl] benzoate;hydrochloride |
| SMILES | Cl.N[C@@H]1CSC[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C11H13NO2S.ClH/c12-9-6-15-7-10(9)14-11(13)8-4-2-1-3-5-8;/h1-5,9-10H,6-7,12H2;1H/t9-,10+;/m1./s1 |
| InChIKey | ZHCUZRREEXOWTD-UXQCFNEQSA-N |
| XLogP | 1.71 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.76 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |