About (4-aminooxan-3-yl) benzoate
(4-aminooxan-3-yl) benzoate (PubChem CID 68668779) has the molecular formula C12H15NO3
and a molecular weight of 221.26 g/mol. Its IUPAC name is (4-aminooxan-3-yl) benzoate.
Molecular Properties
| Compound Name | (4-aminooxan-3-yl) benzoate |
| PubChem CID | 68668779 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | (4-aminooxan-3-yl) benzoate |
| SMILES | NC1CCOCC1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C12H15NO3/c13-10-6-7-15-8-11(10)16-12(14)9-4-2-1-3-5-9/h1-5,10-11H,6-8,13H2 |
| InChIKey | SGUCETRXIZDNDX-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4-aminooxan-3-yl) benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-aminooxan-3-yl) benzoate?
The IUPAC name of (4-aminooxan-3-yl) benzoate (CID 68668779) is (4-aminooxan-3-yl) benzoate.
What is the SMILES notation for (4-aminooxan-3-yl) benzoate?
The canonical SMILES for (4-aminooxan-3-yl) benzoate is NC1CCOCC1OC(=O)c1ccccc1.
What is the InChIKey of (4-aminooxan-3-yl) benzoate?
The InChIKey is SGUCETRXIZDNDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO3/c13-10-6-7-15-8-11(10)16-12(14)9-4-2-1-3-5-9/h1-5,10-11H,6-8,13H2.
What are the key properties of (4-aminooxan-3-yl) benzoate?
(4-aminooxan-3-yl) benzoate has a molecular weight of 221.26 g/mol, XLogP of 0.96, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-aminooxan-3-yl) benzoate is sourced from PubChem (CID 68668779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).