C6H8O5S — CID 10012786
(2S,5R)-5-acetyloxy-1,3-oxathiolane-2-carboxylic acid (PubChem CID 10012786) has the molecular formula C6H8O5S and a molecular weight of 192.19 g/mol. Its IUPAC name is (2S,5R)-5-acetyloxy-1,3-oxathiolane-2-carboxylic acid.
| Compound Name | (2S,5R)-5-acetyloxy-1,3-oxathiolane-2-carboxylic acid |
|---|---|
| PubChem CID | 10012786 |
| Molecular Formula | C6H8O5S |
| Molecular Weight | 192.19 g/mol |
| Exact Mass | 192.01 |
| IUPAC Name | (2S,5R)-5-acetyloxy-1,3-oxathiolane-2-carboxylic acid |
| SMILES | CC(=O)O[C@H]1CS[C@@H](C(=O)O)O1 |
| InChI | InChI=1S/C6H8O5S/c1-3(7)10-4-2-12-6(11-4)5(8)9/h4,6H,2H2,1H3,(H,8,9)/t4-,6+/m1/s1 |
| InChIKey | WRUGSNIJLUOGQF-XINAWCOVSA-N |
| XLogP | 0.05 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.19 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |