C16H18O5 — CID 5461830
[1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-hydroxybut-2-ynyl] benzoate (PubChem CID 5461830) has the molecular formula C16H18O5 and a molecular weight of 290.31 g/mol. Its IUPAC name is [1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-hydroxybut-2-ynyl] benzoate.
| Compound Name | [1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-hydroxybut-2-ynyl] benzoate |
|---|---|
| PubChem CID | 5461830 |
| Molecular Formula | C16H18O5 |
| Molecular Weight | 290.31 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | [1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-hydroxybut-2-ynyl] benzoate |
| SMILES | CC1(C)OC[C@H](C(C#CCO)OC(=O)c2ccccc2)O1 |
| InChI | InChI=1S/C16H18O5/c1-16(2)19-11-14(21-16)13(9-6-10-17)20-15(18)12-7-4-3-5-8-12/h3-5,7-8,13-14,17H,10-11H2,1-2H3/t13?,14-/m1/s1 |
| InChIKey | BELCERWKABDLPU-ARLHGKGLSA-N |
| XLogP | 1.36 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.31 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|