C30H34O8 — CID 10029720
[(1R,2R)-1,2-bis(2,2-dimethyl-1,3-dioxolan-4-yl)-2-[(E)-3-phenylprop-2-enoyl]oxyethyl] (E)-3-phenylprop-2-enoate (PubChem CID 10029720) has the molecular formula C30H34O8 and a molecular weight of 522.59 g/mol. Its IUPAC name is [(1R,2R)-1,2-bis(2,2-dimethyl-1,3-dioxolan-4-yl)-2-[(E)-3-phenylprop-2-enoyl]oxyethyl] (E)-3-phenylprop-2-enoate.
| Compound Name | [(1R,2R)-1,2-bis(2,2-dimethyl-1,3-dioxolan-4-yl)-2-[(E)-3-phenylprop-2-enoyl]oxyethyl] (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 10029720 |
| Molecular Formula | C30H34O8 |
| Molecular Weight | 522.59 g/mol |
| Exact Mass | 522.23 |
| IUPAC Name | [(1R,2R)-1,2-bis(2,2-dimethyl-1,3-dioxolan-4-yl)-2-[(E)-3-phenylprop-2-enoyl]oxyethyl] (E)-3-phenylprop-2-enoate |
| SMILES | CC1(C)OCC([C@@H](OC(=O)/C=C/c2ccccc2)[C@H](OC(=O)/C=C/c2ccccc2)C2COC(C)(C)O2)O1 |
| InChI | InChI=1S/C30H34O8/c1-29(2)33-19-23(37-29)27(35-25(31)17-15-21-11-7-5-8-12-21)28(24-20-34-30(3,4)38-24)36-26(32)18-16-22-13-9-6-10-14-22/h5-18,23-24,27-28H,19-20H2,1-4H3/b17-15+,18-16+/t23?,24?,27-,28-/m1/s1 |
| InChIKey | KSMAIMJDVIXZQP-BSRNYRPOSA-N |
| XLogP | 4.54 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.59 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|