C26H28N2O12 — CID 98528602
[(1R,2R)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(4-nitrobenzoyl)oxyethyl] 4-nitrobenzoate (PubChem CID 98528602) has the molecular formula C26H28N2O12 and a molecular weight of 560.51 g/mol. Its IUPAC name is [(1R,2R)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(4-nitrobenzoyl)oxyethyl] 4-nitrobenzoate.
| Compound Name | [(1R,2R)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(4-nitrobenzoyl)oxyethyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 98528602 |
| Molecular Formula | C26H28N2O12 |
| Molecular Weight | 560.51 g/mol |
| Exact Mass | 560.16 |
| IUPAC Name | [(1R,2R)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(4-nitrobenzoyl)oxyethyl] 4-nitrobenzoate |
| SMILES | CC1(C)OC[C@@H]([C@@H](OC(=O)c2ccc([N+](=O)[O-])cc2)[C@H](OC(=O)c2ccc([N+](=O)[O-])cc2)[C@H]2COC(C)(C)O2)O1 |
| InChI | InChI=1S/C26H28N2O12/c1-25(2)35-13-19(39-25)21(37-23(29)15-5-9-17(10-6-15)27(31)32)22(20-14-36-26(3,4)40-20)38-24(30)16-7-11-18(12-8-16)28(33)34/h5-12,19-22H,13-14H2,1-4H3/t19-,20+,21-,22-/m1/s1 |
| InChIKey | HRIWUCPABXLWNN-CIAFKFPVSA-N |
| XLogP | 3.56 |
| TPSA | 175.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.51 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|