C19H22F2O6 — CID 24785392
ethyl 3-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-difluoro-3-[(E)-3-phenylprop-2-enoyl]oxypropanoate (PubChem CID 24785392) has the molecular formula C19H22F2O6 and a molecular weight of 384.38 g/mol. Its IUPAC name is ethyl 3-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-difluoro-3-[(E)-3-phenylprop-2-enoyl]oxypropanoate.
| Compound Name | ethyl 3-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-difluoro-3-[(E)-3-phenylprop-2-enoyl]oxypropanoate |
|---|---|
| PubChem CID | 24785392 |
| Molecular Formula | C19H22F2O6 |
| Molecular Weight | 384.38 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | ethyl 3-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-difluoro-3-[(E)-3-phenylprop-2-enoyl]oxypropanoate |
| SMILES | CCOC(=O)C(F)(F)C(OC(=O)/C=C/c1ccccc1)C1COC(C)(C)O1 |
| InChI | InChI=1S/C19H22F2O6/c1-4-24-17(23)19(20,21)16(14-12-25-18(2,3)27-14)26-15(22)11-10-13-8-6-5-7-9-13/h5-11,14,16H,4,12H2,1-3H3/b11-10+ |
| InChIKey | MMKIQPPOSNTMHE-ZHACJKMWSA-N |
| XLogP | 2.96 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.38 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|