C17H23NO6 — CID 10854423
ethyl (3S)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-nitro-4-phenylbutanoate (PubChem CID 10854423) has the molecular formula C17H23NO6 and a molecular weight of 337.37 g/mol. Its IUPAC name is ethyl (3S)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-nitro-4-phenylbutanoate.
| Compound Name | ethyl (3S)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-nitro-4-phenylbutanoate |
|---|---|
| PubChem CID | 10854423 |
| Molecular Formula | C17H23NO6 |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | ethyl (3S)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-nitro-4-phenylbutanoate |
| SMILES | CCOC(=O)C[C@@H](C(c1ccccc1)[N+](=O)[O-])[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C17H23NO6/c1-4-22-15(19)10-13(14-11-23-17(2,3)24-14)16(18(20)21)12-8-6-5-7-9-12/h5-9,13-14,16H,4,10-11H2,1-3H3/t13-,14-,16?/m1/s1 |
| InChIKey | LJGCWIKVTKMLIJ-UIDSBSESSA-N |
| XLogP | 2.73 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|