C22H27NO6 — CID 10993079
4-benzhydryloxy-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-nitrobutan-1-ol (PubChem CID 10993079) has the molecular formula C22H27NO6 and a molecular weight of 401.46 g/mol. Its IUPAC name is 4-benzhydryloxy-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-nitrobutan-1-ol.
| Compound Name | 4-benzhydryloxy-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-nitrobutan-1-ol |
|---|---|
| PubChem CID | 10993079 |
| Molecular Formula | C22H27NO6 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | 4-benzhydryloxy-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-nitrobutan-1-ol |
| SMILES | CC1(C)OC[C@H](C(O)C(CCOC(c2ccccc2)c2ccccc2)[N+](=O)[O-])O1 |
| InChI | InChI=1S/C22H27NO6/c1-22(2)28-15-19(29-22)20(24)18(23(25)26)13-14-27-21(16-9-5-3-6-10-16)17-11-7-4-8-12-17/h3-12,18-21,24H,13-15H2,1-2H3/t18?,19-,20?/m1/s1 |
| InChIKey | YJAZFFNAKNYXIH-IOJLRTSASA-N |
| XLogP | 3.34 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|