C23H30N2O5 — CID 134544727
(2S,3S)-2-amino-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxy-N-[(1R,2R)-2-hydroxy-1,2-diphenylethyl]-N-methylpropanamide (PubChem CID 134544727) has the molecular formula C23H30N2O5 and a molecular weight of 414.50 g/mol. Its IUPAC name is (2S,3S)-2-amino-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxy-N-[(1R,2R)-2-hydroxy-1,2-diphenylethyl]-N-methylpropanamide.
| Compound Name | (2S,3S)-2-amino-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxy-N-[(1R,2R)-2-hydroxy-1,2-diphenylethyl]-N-methylpropanamide |
|---|---|
| PubChem CID | 134544727 |
| Molecular Formula | C23H30N2O5 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | (2S,3S)-2-amino-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxy-N-[(1R,2R)-2-hydroxy-1,2-diphenylethyl]-N-methylpropanamide |
| SMILES | CN(C(=O)[C@@H](N)[C@H](O)[C@H]1COC(C)(C)O1)[C@H](c1ccccc1)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C23H30N2O5/c1-23(2)29-14-17(30-23)21(27)18(24)22(28)25(3)19(15-10-6-4-7-11-15)20(26)16-12-8-5-9-13-16/h4-13,17-21,26-27H,14,24H2,1-3H3/t17-,18+,19-,20-,21-/m1/s1 |
| InChIKey | QJLXHIGGDCJNSO-FDKIHUSFSA-N |
| XLogP | 1.76 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |