C13H17NO4 — CID 122388100
N-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-hydroxymethyl]benzamide (PubChem CID 122388100) has the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. Its IUPAC name is N-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-hydroxymethyl]benzamide.
| Compound Name | N-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-hydroxymethyl]benzamide |
|---|---|
| PubChem CID | 122388100 |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | N-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-hydroxymethyl]benzamide |
| SMILES | CC1(C)OC[C@H](C(O)NC(=O)c2ccccc2)O1 |
| InChI | InChI=1S/C13H17NO4/c1-13(2)17-8-10(18-13)12(16)14-11(15)9-6-4-3-5-7-9/h3-7,10,12,16H,8H2,1-2H3,(H,14,15)/t10-,12?/m1/s1 |
| InChIKey | SXGQDLGZFPFWJU-RWANSRKNSA-N |
| XLogP | 0.89 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|