C18H28O5 — CID 135013606
(1S,2R,3S)-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-[(2-methylpropan-2-yl)oxy]-1-phenylpropane-1,2-diol (PubChem CID 135013606) has the molecular formula C18H28O5 and a molecular weight of 324.42 g/mol. Its IUPAC name is (1S,2R,3S)-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-[(2-methylpropan-2-yl)oxy]-1-phenylpropane-1,2-diol.
| Compound Name | (1S,2R,3S)-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-[(2-methylpropan-2-yl)oxy]-1-phenylpropane-1,2-diol |
|---|---|
| PubChem CID | 135013606 |
| Molecular Formula | C18H28O5 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | (1S,2R,3S)-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-[(2-methylpropan-2-yl)oxy]-1-phenylpropane-1,2-diol |
| SMILES | CC(C)(C)O[C@@H]([C@H](O)[C@@H](O)c1ccccc1)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C18H28O5/c1-17(2,3)23-16(13-11-21-18(4,5)22-13)15(20)14(19)12-9-7-6-8-10-12/h6-10,13-16,19-20H,11H2,1-5H3/t13-,14+,15-,16-/m1/s1 |
| InChIKey | BKFPXLCNNUZGSB-QKPAOTATSA-N |
| XLogP | 2.42 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |