C25H36O4Si — CID 132850699
(4S)-4-[tert-butyl(diphenyl)silyl]oxy-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]butan-2-ol (PubChem CID 132850699) has the molecular formula C25H36O4Si and a molecular weight of 428.65 g/mol. Its IUPAC name is (4S)-4-[tert-butyl(diphenyl)silyl]oxy-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]butan-2-ol.
| Compound Name | (4S)-4-[tert-butyl(diphenyl)silyl]oxy-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]butan-2-ol |
|---|---|
| PubChem CID | 132850699 |
| Molecular Formula | C25H36O4Si |
| Molecular Weight | 428.65 g/mol |
| Exact Mass | 428.24 |
| IUPAC Name | (4S)-4-[tert-butyl(diphenyl)silyl]oxy-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]butan-2-ol |
| SMILES | CC(O)C[C@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C25H36O4Si/c1-19(26)17-22(23-18-27-25(5,6)28-23)29-30(24(2,3)4,20-13-9-7-10-14-20)21-15-11-8-12-16-21/h7-16,19,22-23,26H,17-18H2,1-6H3/t19?,22-,23+/m0/s1 |
| InChIKey | QQUMPCMFUIMOMZ-NWZLQDFTSA-N |
| XLogP | 3.85 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.65 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|