C28H42O4Si — CID 141485300
tert-butyl-[(2R,4R)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methoxy-2-methylpentoxy]-diphenylsilane (PubChem CID 141485300) has the molecular formula C28H42O4Si and a molecular weight of 470.73 g/mol. Its IUPAC name is tert-butyl-[(2R,4R)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methoxy-2-methylpentoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(2R,4R)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methoxy-2-methylpentoxy]-diphenylsilane |
|---|---|
| PubChem CID | 141485300 |
| Molecular Formula | C28H42O4Si |
| Molecular Weight | 470.73 g/mol |
| Exact Mass | 470.29 |
| IUPAC Name | tert-butyl-[(2R,4R)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methoxy-2-methylpentoxy]-diphenylsilane |
| SMILES | CO[C@](C)(C[C@@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C28H42O4Si/c1-22(19-28(7,29-8)25-21-30-27(5,6)32-25)20-31-33(26(2,3)4,23-15-11-9-12-16-23)24-17-13-10-14-18-24/h9-18,22,25H,19-21H2,1-8H3/t22-,25-,28-/m1/s1 |
| InChIKey | KWQIGIOFRBOBPI-WSOLHVCVSA-N |
| XLogP | 5.15 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.73 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|