C28H40O2Si — CID 135079027
tert-butyl-[(E,2R)-2,4-dimethyl-8-[(2S)-oxiran-2-yl]oct-4-enoxy]-diphenylsilane (PubChem CID 135079027) has the molecular formula C28H40O2Si and a molecular weight of 436.71 g/mol. Its IUPAC name is tert-butyl-[(E,2R)-2,4-dimethyl-8-[(2S)-oxiran-2-yl]oct-4-enoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(E,2R)-2,4-dimethyl-8-[(2S)-oxiran-2-yl]oct-4-enoxy]-diphenylsilane |
|---|---|
| PubChem CID | 135079027 |
| Molecular Formula | C28H40O2Si |
| Molecular Weight | 436.71 g/mol |
| Exact Mass | 436.28 |
| IUPAC Name | tert-butyl-[(E,2R)-2,4-dimethyl-8-[(2S)-oxiran-2-yl]oct-4-enoxy]-diphenylsilane |
| SMILES | C/C(=C\CCC[C@H]1CO1)C[C@@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C28H40O2Si/c1-23(14-12-13-15-25-22-29-25)20-24(2)21-30-31(28(3,4)5,26-16-8-6-9-17-26)27-18-10-7-11-19-27/h6-11,14,16-19,24-25H,12-13,15,20-22H2,1-5H3/b23-14+/t24-,25+/m1/s1 |
| InChIKey | WNRJXQJQVWYDTH-HDFXIGACSA-N |
| XLogP | 6.10 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.71 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|