C30H44O4Si — CID 165163184
tert-butyl-[(2R,4R)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methyl-4-prop-2-enoxypentoxy]-diphenylsilane (PubChem CID 165163184) has the molecular formula C30H44O4Si and a molecular weight of 496.76 g/mol. Its IUPAC name is tert-butyl-[(2R,4R)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methyl-4-prop-2-enoxypentoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(2R,4R)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methyl-4-prop-2-enoxypentoxy]-diphenylsilane |
|---|---|
| PubChem CID | 165163184 |
| Molecular Formula | C30H44O4Si |
| Molecular Weight | 496.76 g/mol |
| Exact Mass | 496.30 |
| IUPAC Name | tert-butyl-[(2R,4R)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methyl-4-prop-2-enoxypentoxy]-diphenylsilane |
| SMILES | C=CCO[C@](C)(C[C@@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C30H44O4Si/c1-9-20-31-30(8,27-23-32-29(6,7)34-27)21-24(2)22-33-35(28(3,4)5,25-16-12-10-13-17-25)26-18-14-11-15-19-26/h9-19,24,27H,1,20-23H2,2-8H3/t24-,27-,30-/m1/s1 |
| InChIKey | WCPJWLDWCULMSH-UCVANPEUSA-N |
| XLogP | 5.70 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.76 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|