C34H47NO4Si — CID 102069591
(2R)-1-[tert-butyl(diphenyl)silyl]oxy-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-N-phenylmethoxyhexan-2-amine (PubChem CID 102069591) has the molecular formula C34H47NO4Si and a molecular weight of 561.84 g/mol. Its IUPAC name is (2R)-1-[tert-butyl(diphenyl)silyl]oxy-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-N-phenylmethoxyhexan-2-amine.
| Compound Name | (2R)-1-[tert-butyl(diphenyl)silyl]oxy-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-N-phenylmethoxyhexan-2-amine |
|---|---|
| PubChem CID | 102069591 |
| Molecular Formula | C34H47NO4Si |
| Molecular Weight | 561.84 g/mol |
| Exact Mass | 561.33 |
| IUPAC Name | (2R)-1-[tert-butyl(diphenyl)silyl]oxy-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-N-phenylmethoxyhexan-2-amine |
| SMILES | CCCC[C@](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)(NOCc1ccccc1)[C@@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C34H47NO4Si/c1-7-8-24-34(31-26-36-33(5,6)39-31,35-37-25-28-18-12-9-13-19-28)27-38-40(32(2,3)4,29-20-14-10-15-21-29)30-22-16-11-17-23-30/h9-23,31,35H,7-8,24-27H2,1-6H3/t31-,34+/m0/s1 |
| InChIKey | LBEFVGSZPWJGEK-AFPLUKJUSA-N |
| XLogP | 6.36 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.84 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|