C39H47N3O6Si — CID 10699736
benzyl N-[N'-[(4R,5R)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxan-5-yl]-N-phenylmethoxycarbamimidoyl]carbamate (PubChem CID 10699736) has the molecular formula C39H47N3O6Si and a molecular weight of 681.91 g/mol. Its IUPAC name is benzyl N-[N'-[(4R,5R)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxan-5-yl]-N-phenylmethoxycarbamimidoyl]carbamate.
| Compound Name | benzyl N-[N'-[(4R,5R)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxan-5-yl]-N-phenylmethoxycarbamimidoyl]carbamate |
|---|---|
| PubChem CID | 10699736 |
| Molecular Formula | C39H47N3O6Si |
| Molecular Weight | 681.91 g/mol |
| Exact Mass | 681.32 |
| IUPAC Name | benzyl N-[N'-[(4R,5R)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxan-5-yl]-N-phenylmethoxycarbamimidoyl]carbamate |
| SMILES | CC1(C)OC[C@@H](/N=C(\NOCc2ccccc2)NC(=O)OCc2ccccc2)[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O1 |
| InChI | InChI=1S/C39H47N3O6Si/c1-38(2,3)49(32-22-14-8-15-23-32,33-24-16-9-17-25-33)47-29-35-34(28-45-39(4,5)48-35)40-36(42-46-27-31-20-12-7-13-21-31)41-37(43)44-26-30-18-10-6-11-19-30/h6-25,34-35H,26-29H2,1-5H3,(H2,40,41,42,43)/t34-,35+/m1/s1 |
| InChIKey | HEFULUBZBIWNJE-GPOMZPHUSA-N |
| XLogP | 6.09 |
| TPSA | 99.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.91 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|