C33H42O5Si — CID 18944151
3-[2-[[4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxan-5-yl]methyl]phenyl]propanoic acid (PubChem CID 18944151) has the molecular formula C33H42O5Si and a molecular weight of 546.78 g/mol. Its IUPAC name is 3-[2-[[4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxan-5-yl]methyl]phenyl]propanoic acid.
| Compound Name | 3-[2-[[4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxan-5-yl]methyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 18944151 |
| Molecular Formula | C33H42O5Si |
| Molecular Weight | 546.78 g/mol |
| Exact Mass | 546.28 |
| IUPAC Name | 3-[2-[[4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxan-5-yl]methyl]phenyl]propanoic acid |
| SMILES | CC1(C)OCC(Cc2ccccc2CCC(=O)O)C(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O1 |
| InChI | InChI=1S/C33H42O5Si/c1-32(2,3)39(28-16-8-6-9-17-28,29-18-10-7-11-19-29)37-24-30-27(23-36-33(4,5)38-30)22-26-15-13-12-14-25(26)20-21-31(34)35/h6-19,27,30H,20-24H2,1-5H3,(H,34,35) |
| InChIKey | HQFSLZPMRHTRPN-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.78 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|