C31H40O5SSi — CID 91262253
tert-butyl-[[2,2-dimethyl-4-[(3-methylphenyl)sulfonylmethyl]-1,3-dioxan-5-yl]methoxy]-diphenylsilane (PubChem CID 91262253) has the molecular formula C31H40O5SSi and a molecular weight of 552.81 g/mol. Its IUPAC name is tert-butyl-[[2,2-dimethyl-4-[(3-methylphenyl)sulfonylmethyl]-1,3-dioxan-5-yl]methoxy]-diphenylsilane.
| Compound Name | tert-butyl-[[2,2-dimethyl-4-[(3-methylphenyl)sulfonylmethyl]-1,3-dioxan-5-yl]methoxy]-diphenylsilane |
|---|---|
| PubChem CID | 91262253 |
| Molecular Formula | C31H40O5SSi |
| Molecular Weight | 552.81 g/mol |
| Exact Mass | 552.24 |
| IUPAC Name | tert-butyl-[[2,2-dimethyl-4-[(3-methylphenyl)sulfonylmethyl]-1,3-dioxan-5-yl]methoxy]-diphenylsilane |
| SMILES | Cc1cccc(S(=O)(=O)CC2OC(C)(C)OCC2CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)c1 |
| InChI | InChI=1S/C31H40O5SSi/c1-24-14-13-15-26(20-24)37(32,33)23-29-25(21-34-31(5,6)36-29)22-35-38(30(2,3)4,27-16-9-7-10-17-27)28-18-11-8-12-19-28/h7-20,25,29H,21-23H2,1-6H3 |
| InChIKey | XHFADRBFXVSZRN-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.81 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|