C31H38O7SSi — CID 11146295
(3aR,4R,6R,6aR)-4-(benzenesulfonylmethyl)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-ol (PubChem CID 11146295) has the molecular formula C31H38O7SSi and a molecular weight of 582.79 g/mol. Its IUPAC name is (3aR,4R,6R,6aR)-4-(benzenesulfonylmethyl)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-ol.
| Compound Name | (3aR,4R,6R,6aR)-4-(benzenesulfonylmethyl)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-ol |
|---|---|
| PubChem CID | 11146295 |
| Molecular Formula | C31H38O7SSi |
| Molecular Weight | 582.79 g/mol |
| Exact Mass | 582.21 |
| IUPAC Name | (3aR,4R,6R,6aR)-4-(benzenesulfonylmethyl)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-ol |
| SMILES | CC1(C)O[C@H]2[C@@H](O1)[C@](O)(CS(=O)(=O)c1ccccc1)O[C@@H]2CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C31H38O7SSi/c1-29(2,3)40(24-17-11-7-12-18-24,25-19-13-8-14-20-25)35-21-26-27-28(38-30(4,5)37-27)31(32,36-26)22-39(33,34)23-15-9-6-10-16-23/h6-20,26-28,32H,21-22H2,1-5H3/t26-,27-,28-,31+/m1/s1 |
| InChIKey | YORNNRZQSDMYFH-WIXZECKYSA-N |
| XLogP | 3.64 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.79 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|