C25H28O4SSi — CID 11762183
[(2R,3S)-3-(benzenesulfonyl)oxiran-2-yl]methoxy-tert-butyl-diphenylsilane (PubChem CID 11762183) has the molecular formula C25H28O4SSi and a molecular weight of 452.65 g/mol. Its IUPAC name is [(2R,3S)-3-(benzenesulfonyl)oxiran-2-yl]methoxy-tert-butyl-diphenylsilane.
| Compound Name | [(2R,3S)-3-(benzenesulfonyl)oxiran-2-yl]methoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 11762183 |
| Molecular Formula | C25H28O4SSi |
| Molecular Weight | 452.65 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | [(2R,3S)-3-(benzenesulfonyl)oxiran-2-yl]methoxy-tert-butyl-diphenylsilane |
| SMILES | CC(C)(C)[Si](OC[C@H]1O[C@H]1S(=O)(=O)c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H28O4SSi/c1-25(2,3)31(21-15-9-5-10-16-21,22-17-11-6-12-18-22)28-19-23-24(29-23)30(26,27)20-13-7-4-8-14-20/h4-18,23-24H,19H2,1-3H3/t23-,24+/m1/s1 |
| InChIKey | LZYHUZZVVJVQOH-RPWUZVMVSA-N |
| XLogP | 3.76 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.65 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|