C27H36O7Si — CID 102120982
ethyl (3aR,6R,6aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-hydroxy-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4-carboxylate (PubChem CID 102120982) has the molecular formula C27H36O7Si and a molecular weight of 500.66 g/mol. Its IUPAC name is ethyl (3aR,6R,6aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-hydroxy-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4-carboxylate.
| Compound Name | ethyl (3aR,6R,6aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-hydroxy-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4-carboxylate |
|---|---|
| PubChem CID | 102120982 |
| Molecular Formula | C27H36O7Si |
| Molecular Weight | 500.66 g/mol |
| Exact Mass | 500.22 |
| IUPAC Name | ethyl (3aR,6R,6aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-hydroxy-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4-carboxylate |
| SMILES | CCOC(=O)C1(O)O[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C27H36O7Si/c1-7-30-24(28)27(29)23-22(33-26(5,6)34-23)21(32-27)18-31-35(25(2,3)4,19-14-10-8-11-15-19)20-16-12-9-13-17-20/h8-17,21-23,29H,7,18H2,1-6H3/t21-,22-,23-,27?/m1/s1 |
| InChIKey | AXYSRRQEZFIJHM-IANNTBFTSA-N |
| XLogP | 2.73 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.66 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|