C28H37FO6Si — CID 102260340
ethyl (4S,4aS,6R,7aR)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-fluoro-2,2-dimethyl-4,4a,7,7a-tetrahydrofuro[3,2-d][1,3]dioxine-6-carboxylate (PubChem CID 102260340) has the molecular formula C28H37FO6Si and a molecular weight of 516.68 g/mol. Its IUPAC name is ethyl (4S,4aS,6R,7aR)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-fluoro-2,2-dimethyl-4,4a,7,7a-tetrahydrofuro[3,2-d][1,3]dioxine-6-carboxylate.
| Compound Name | ethyl (4S,4aS,6R,7aR)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-fluoro-2,2-dimethyl-4,4a,7,7a-tetrahydrofuro[3,2-d][1,3]dioxine-6-carboxylate |
|---|---|
| PubChem CID | 102260340 |
| Molecular Formula | C28H37FO6Si |
| Molecular Weight | 516.68 g/mol |
| Exact Mass | 516.23 |
| IUPAC Name | ethyl (4S,4aS,6R,7aR)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-fluoro-2,2-dimethyl-4,4a,7,7a-tetrahydrofuro[3,2-d][1,3]dioxine-6-carboxylate |
| SMILES | CCOC(=O)[C@]1(F)C[C@H]2OC(C)(C)O[C@@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)[C@H]2O1 |
| InChI | InChI=1S/C28H37FO6Si/c1-7-31-25(30)28(29)18-22-24(35-28)23(34-27(5,6)33-22)19-32-36(26(2,3)4,20-14-10-8-11-15-20)21-16-12-9-13-17-21/h8-17,22-24H,7,18-19H2,1-6H3/t22-,23+,24+,28+/m1/s1 |
| InChIKey | PVHPSXYJSHATGB-DELVEFKNSA-N |
| XLogP | 4.10 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.68 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|