C25H31N3O5Si — CID 134831448
ethyl 5-azido-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,7-dioxabicyclo[2.2.1]heptane-1-carboxylate (PubChem CID 134831448) has the molecular formula C25H31N3O5Si and a molecular weight of 481.63 g/mol. Its IUPAC name is ethyl 5-azido-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,7-dioxabicyclo[2.2.1]heptane-1-carboxylate.
| Compound Name | ethyl 5-azido-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,7-dioxabicyclo[2.2.1]heptane-1-carboxylate |
|---|---|
| PubChem CID | 134831448 |
| Molecular Formula | C25H31N3O5Si |
| Molecular Weight | 481.63 g/mol |
| Exact Mass | 481.20 |
| IUPAC Name | ethyl 5-azido-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,7-dioxabicyclo[2.2.1]heptane-1-carboxylate |
| SMILES | CCOC(=O)C12CC(N=[N+]=[N-])C(O1)C(CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)O2 |
| InChI | InChI=1S/C25H31N3O5Si/c1-5-30-23(29)25-16-20(27-28-26)22(33-25)21(32-25)17-31-34(24(2,3)4,18-12-8-6-9-13-18)19-14-10-7-11-15-19/h6-15,20-22H,5,16-17H2,1-4H3 |
| InChIKey | HLMVHRRKCZANSQ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 102.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.63 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|