C35H36N6O4SSi — CID 71763861
[(2S,3R,4S,5R,6S)-3,5-diazido-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-phenylsulfanyloxan-4-yl] benzoate (PubChem CID 71763861) has the molecular formula C35H36N6O4SSi and a molecular weight of 664.86 g/mol. Its IUPAC name is [(2S,3R,4S,5R,6S)-3,5-diazido-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-phenylsulfanyloxan-4-yl] benzoate.
| Compound Name | [(2S,3R,4S,5R,6S)-3,5-diazido-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-phenylsulfanyloxan-4-yl] benzoate |
|---|---|
| PubChem CID | 71763861 |
| Molecular Formula | C35H36N6O4SSi |
| Molecular Weight | 664.86 g/mol |
| Exact Mass | 664.23 |
| IUPAC Name | [(2S,3R,4S,5R,6S)-3,5-diazido-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-phenylsulfanyloxan-4-yl] benzoate |
| SMILES | CC(C)(C)[Si](OC[C@H]1O[C@@H](Sc2ccccc2)[C@H](N=[N+]=[N-])[C@@H](OC(=O)c2ccccc2)[C@H]1N=[N+]=[N-])(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H36N6O4SSi/c1-35(2,3)47(27-20-12-6-13-21-27,28-22-14-7-15-23-28)43-24-29-30(38-40-36)32(45-33(42)25-16-8-4-9-17-25)31(39-41-37)34(44-29)46-26-18-10-5-11-19-26/h4-23,29-32,34H,24H2,1-3H3/t29-,30+,31-,32+,34+/m1/s1 |
| InChIKey | ANTHSLGBQYSONS-HXFXIHAOSA-N |
| XLogP | 7.66 |
| TPSA | 142.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.86 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|