C29H25N3O5S — CID 132516925
[(2R,3S,4R,5R,6R)-5-azido-3-hydroxy-2-(naphthalen-2-yloxymethyl)-6-phenylsulfanyloxan-4-yl] benzoate (PubChem CID 132516925) has the molecular formula C29H25N3O5S and a molecular weight of 527.60 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6R)-5-azido-3-hydroxy-2-(naphthalen-2-yloxymethyl)-6-phenylsulfanyloxan-4-yl] benzoate.
| Compound Name | [(2R,3S,4R,5R,6R)-5-azido-3-hydroxy-2-(naphthalen-2-yloxymethyl)-6-phenylsulfanyloxan-4-yl] benzoate |
|---|---|
| PubChem CID | 132516925 |
| Molecular Formula | C29H25N3O5S |
| Molecular Weight | 527.60 g/mol |
| Exact Mass | 527.15 |
| IUPAC Name | [(2R,3S,4R,5R,6R)-5-azido-3-hydroxy-2-(naphthalen-2-yloxymethyl)-6-phenylsulfanyloxan-4-yl] benzoate |
| SMILES | [N-]=[N+]=N[C@@H]1[C@@H](OC(=O)c2ccccc2)[C@H](O)[C@@H](COc2ccc3ccccc3c2)O[C@@H]1Sc1ccccc1 |
| InChI | InChI=1S/C29H25N3O5S/c30-32-31-25-27(37-28(34)20-10-3-1-4-11-20)26(33)24(36-29(25)38-23-13-5-2-6-14-23)18-35-22-16-15-19-9-7-8-12-21(19)17-22/h1-17,24-27,29,33H,18H2/t24-,25-,26-,27-,29-/m1/s1 |
| InChIKey | DIEZGWOTDWICMM-QPCYKJICSA-N |
| XLogP | 6.00 |
| TPSA | 113.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.60 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|