C27H24N6O5S — CID 11398659
[(2R,3R,4S,5S,6S)-3-azido-2-(azidomethyl)-5-benzoyloxy-6-(4-methylphenyl)sulfanyloxan-4-yl] benzoate (PubChem CID 11398659) has the molecular formula C27H24N6O5S and a molecular weight of 544.59 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6S)-3-azido-2-(azidomethyl)-5-benzoyloxy-6-(4-methylphenyl)sulfanyloxan-4-yl] benzoate.
| Compound Name | [(2R,3R,4S,5S,6S)-3-azido-2-(azidomethyl)-5-benzoyloxy-6-(4-methylphenyl)sulfanyloxan-4-yl] benzoate |
|---|---|
| PubChem CID | 11398659 |
| Molecular Formula | C27H24N6O5S |
| Molecular Weight | 544.59 g/mol |
| Exact Mass | 544.15 |
| IUPAC Name | [(2R,3R,4S,5S,6S)-3-azido-2-(azidomethyl)-5-benzoyloxy-6-(4-methylphenyl)sulfanyloxan-4-yl] benzoate |
| SMILES | Cc1ccc(S[C@@H]2O[C@H](CN=[N+]=[N-])[C@@H](N=[N+]=[N-])[C@H](OC(=O)c3ccccc3)[C@@H]2OC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H24N6O5S/c1-17-12-14-20(15-13-17)39-27-24(38-26(35)19-10-6-3-7-11-19)23(37-25(34)18-8-4-2-5-9-18)22(31-33-29)21(36-27)16-30-32-28/h2-15,21-24,27H,16H2,1H3/t21-,22-,23+,24+,27+/m1/s1 |
| InChIKey | JHBVCUQEYWGKBN-TXDQRGGKSA-N |
| XLogP | 6.25 |
| TPSA | 159.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.59 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|