C26H25N3O4S — CID 11662915
[(2R,3S,4S,5R,6S)-4-azido-2-methyl-5-phenylmethoxy-6-phenylsulfanyloxan-3-yl] benzoate (PubChem CID 11662915) has the molecular formula C26H25N3O4S and a molecular weight of 475.57 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-4-azido-2-methyl-5-phenylmethoxy-6-phenylsulfanyloxan-3-yl] benzoate.
| Compound Name | [(2R,3S,4S,5R,6S)-4-azido-2-methyl-5-phenylmethoxy-6-phenylsulfanyloxan-3-yl] benzoate |
|---|---|
| PubChem CID | 11662915 |
| Molecular Formula | C26H25N3O4S |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.16 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-4-azido-2-methyl-5-phenylmethoxy-6-phenylsulfanyloxan-3-yl] benzoate |
| SMILES | C[C@H]1O[C@@H](Sc2ccccc2)[C@H](OCc2ccccc2)[C@@H](N=[N+]=[N-])[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C26H25N3O4S/c1-18-23(33-25(30)20-13-7-3-8-14-20)22(28-29-27)24(31-17-19-11-5-2-6-12-19)26(32-18)34-21-15-9-4-10-16-21/h2-16,18,22-24,26H,17H2,1H3/t18-,22+,23-,24-,26+/m1/s1 |
| InChIKey | XARWDIJCGNMZCR-CTCBWZERSA-N |
| XLogP | 6.01 |
| TPSA | 93.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|