C29H29ClO6S — CID 44598557
[(2S,3R,4R,5S,6S)-4-(2-chloroacetyl)oxy-6-methyl-2-(4-methylphenyl)sulfanyl-5-phenylmethoxyoxan-3-yl] benzoate (PubChem CID 44598557) has the molecular formula C29H29ClO6S and a molecular weight of 541.07 g/mol. Its IUPAC name is [(2S,3R,4R,5S,6S)-4-(2-chloroacetyl)oxy-6-methyl-2-(4-methylphenyl)sulfanyl-5-phenylmethoxyoxan-3-yl] benzoate.
| Compound Name | [(2S,3R,4R,5S,6S)-4-(2-chloroacetyl)oxy-6-methyl-2-(4-methylphenyl)sulfanyl-5-phenylmethoxyoxan-3-yl] benzoate |
|---|---|
| PubChem CID | 44598557 |
| Molecular Formula | C29H29ClO6S |
| Molecular Weight | 541.07 g/mol |
| Exact Mass | 540.14 |
| IUPAC Name | [(2S,3R,4R,5S,6S)-4-(2-chloroacetyl)oxy-6-methyl-2-(4-methylphenyl)sulfanyl-5-phenylmethoxyoxan-3-yl] benzoate |
| SMILES | Cc1ccc(S[C@@H]2O[C@@H](C)[C@H](OCc3ccccc3)[C@@H](OC(=O)CCl)[C@H]2OC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H29ClO6S/c1-19-13-15-23(16-14-19)37-29-27(36-28(32)22-11-7-4-8-12-22)26(35-24(31)17-30)25(20(2)34-29)33-18-21-9-5-3-6-10-21/h3-16,20,25-27,29H,17-18H2,1-2H3/t20-,25-,26+,27+,29-/m0/s1 |
| InChIKey | XIAQJJBBWSWEIH-ACBJVMNASA-N |
| XLogP | 5.79 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.07 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|