C24H33ClO7S — CID 100998841
[(2R,3S,4S,5R,6S)-3-(2-chloroacetyl)oxy-5-(2,2-dimethylpropanoyloxy)-2-methyl-6-phenylsulfanyloxan-4-yl] 2,2-dimethylpropanoate (PubChem CID 100998841) has the molecular formula C24H33ClO7S and a molecular weight of 501.04 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-3-(2-chloroacetyl)oxy-5-(2,2-dimethylpropanoyloxy)-2-methyl-6-phenylsulfanyloxan-4-yl] 2,2-dimethylpropanoate.
| Compound Name | [(2R,3S,4S,5R,6S)-3-(2-chloroacetyl)oxy-5-(2,2-dimethylpropanoyloxy)-2-methyl-6-phenylsulfanyloxan-4-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 100998841 |
| Molecular Formula | C24H33ClO7S |
| Molecular Weight | 501.04 g/mol |
| Exact Mass | 500.16 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-3-(2-chloroacetyl)oxy-5-(2,2-dimethylpropanoyloxy)-2-methyl-6-phenylsulfanyloxan-4-yl] 2,2-dimethylpropanoate |
| SMILES | C[C@H]1O[C@@H](Sc2ccccc2)[C@H](OC(=O)C(C)(C)C)[C@@H](OC(=O)C(C)(C)C)[C@H]1OC(=O)CCl |
| InChI | InChI=1S/C24H33ClO7S/c1-14-17(30-16(26)13-25)18(31-21(27)23(2,3)4)19(32-22(28)24(5,6)7)20(29-14)33-15-11-9-8-10-12-15/h8-12,14,17-20H,13H2,1-7H3/t14-,17+,18+,19-,20+/m1/s1 |
| InChIKey | HJWNMIBIGKVAQM-OITRIXBGSA-N |
| XLogP | 4.59 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.04 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|