C28H36O14S — CID 102177734
[(2R,3R,4S,5S,6S)-4,5-diacetyloxy-6-[[(2R,3R,4S,5R,6S)-4,5-diacetyloxy-3-hydroxy-6-phenylsulfanyloxan-2-yl]methoxy]-2-methyloxan-3-yl] acetate (PubChem CID 102177734) has the molecular formula C28H36O14S and a molecular weight of 628.65 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6S)-4,5-diacetyloxy-6-[[(2R,3R,4S,5R,6S)-4,5-diacetyloxy-3-hydroxy-6-phenylsulfanyloxan-2-yl]methoxy]-2-methyloxan-3-yl] acetate.
| Compound Name | [(2R,3R,4S,5S,6S)-4,5-diacetyloxy-6-[[(2R,3R,4S,5R,6S)-4,5-diacetyloxy-3-hydroxy-6-phenylsulfanyloxan-2-yl]methoxy]-2-methyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 102177734 |
| Molecular Formula | C28H36O14S |
| Molecular Weight | 628.65 g/mol |
| Exact Mass | 628.18 |
| IUPAC Name | [(2R,3R,4S,5S,6S)-4,5-diacetyloxy-6-[[(2R,3R,4S,5R,6S)-4,5-diacetyloxy-3-hydroxy-6-phenylsulfanyloxan-2-yl]methoxy]-2-methyloxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@H](OC(C)=O)[C@@H](OC[C@H]2O[C@@H](Sc3ccccc3)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]2O)O[C@H](C)[C@H]1OC(C)=O |
| InChI | InChI=1S/C28H36O14S/c1-13-22(37-14(2)29)24(39-16(4)31)25(40-17(5)32)27(36-13)35-12-20-21(34)23(38-15(3)30)26(41-18(6)33)28(42-20)43-19-10-8-7-9-11-19/h7-11,13,20-28,34H,12H2,1-6H3/t13-,20-,21-,22-,23+,24+,25+,26-,27+,28+/m1/s1 |
| InChIKey | LGPDPGZAQXWSDJ-YOOPUKTJSA-N |
| XLogP | 1.28 |
| TPSA | 179.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.65 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|