C24H27NO4S2 — CID 132532774
[(2S,3S,4R,5S,6R)-3-hydroxy-2-methyl-5,6-bis(phenylsulfanyl)oxan-4-yl] 3-cyano-2,2-dimethylpropanoate (PubChem CID 132532774) has the molecular formula C24H27NO4S2 and a molecular weight of 457.62 g/mol. Its IUPAC name is [(2S,3S,4R,5S,6R)-3-hydroxy-2-methyl-5,6-bis(phenylsulfanyl)oxan-4-yl] 3-cyano-2,2-dimethylpropanoate.
| Compound Name | [(2S,3S,4R,5S,6R)-3-hydroxy-2-methyl-5,6-bis(phenylsulfanyl)oxan-4-yl] 3-cyano-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 132532774 |
| Molecular Formula | C24H27NO4S2 |
| Molecular Weight | 457.62 g/mol |
| Exact Mass | 457.14 |
| IUPAC Name | [(2S,3S,4R,5S,6R)-3-hydroxy-2-methyl-5,6-bis(phenylsulfanyl)oxan-4-yl] 3-cyano-2,2-dimethylpropanoate |
| SMILES | C[C@@H]1O[C@H](Sc2ccccc2)[C@@H](Sc2ccccc2)[C@H](OC(=O)C(C)(C)CC#N)[C@H]1O |
| InChI | InChI=1S/C24H27NO4S2/c1-16-19(26)20(29-23(27)24(2,3)14-15-25)21(30-17-10-6-4-7-11-17)22(28-16)31-18-12-8-5-9-13-18/h4-13,16,19-22,26H,14H2,1-3H3/t16-,19-,20+,21-,22+/m0/s1 |
| InChIKey | GQWZHDCDOBOLCB-GSNCRSPSSA-N |
| XLogP | 4.90 |
| TPSA | 79.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.62 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |