C19H18N6O3S — CID 132851112
[(2S,3S,4R,5S,6R)-4,5-diazido-2-methyl-6-phenylsulfanyloxan-3-yl] benzoate (PubChem CID 132851112) has the molecular formula C19H18N6O3S and a molecular weight of 410.46 g/mol. Its IUPAC name is [(2S,3S,4R,5S,6R)-4,5-diazido-2-methyl-6-phenylsulfanyloxan-3-yl] benzoate.
| Compound Name | [(2S,3S,4R,5S,6R)-4,5-diazido-2-methyl-6-phenylsulfanyloxan-3-yl] benzoate |
|---|---|
| PubChem CID | 132851112 |
| Molecular Formula | C19H18N6O3S |
| Molecular Weight | 410.46 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | [(2S,3S,4R,5S,6R)-4,5-diazido-2-methyl-6-phenylsulfanyloxan-3-yl] benzoate |
| SMILES | C[C@@H]1O[C@H](Sc2ccccc2)[C@@H](N=[N+]=[N-])[C@@H](N=[N+]=[N-])[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C19H18N6O3S/c1-12-17(28-18(26)13-8-4-2-5-9-13)15(22-24-20)16(23-25-21)19(27-12)29-14-10-6-3-7-11-14/h2-12,15-17,19H,1H3/t12-,15+,16-,17+,19+/m0/s1 |
| InChIKey | KPSMEQPCQRJAOG-LPNZSRGHSA-N |
| XLogP | 5.11 |
| TPSA | 133.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.46 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|