C30H35N3O5SSi — CID 173486964
[(3S,6S)-5-azido-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-hydroxy-6-methylsulfanyloxan-4-yl] benzoate (PubChem CID 173486964) has the molecular formula C30H35N3O5SSi and a molecular weight of 577.78 g/mol. Its IUPAC name is [(3S,6S)-5-azido-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-hydroxy-6-methylsulfanyloxan-4-yl] benzoate.
| Compound Name | [(3S,6S)-5-azido-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-hydroxy-6-methylsulfanyloxan-4-yl] benzoate |
|---|---|
| PubChem CID | 173486964 |
| Molecular Formula | C30H35N3O5SSi |
| Molecular Weight | 577.78 g/mol |
| Exact Mass | 577.21 |
| IUPAC Name | [(3S,6S)-5-azido-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-hydroxy-6-methylsulfanyloxan-4-yl] benzoate |
| SMILES | CS[C@@H]1OC(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H](O)C(OC(=O)c2ccccc2)C1N=[N+]=[N-] |
| InChI | InChI=1S/C30H35N3O5SSi/c1-30(2,3)40(22-16-10-6-11-17-22,23-18-12-7-13-19-23)36-20-24-26(34)27(25(32-33-31)29(37-24)39-4)38-28(35)21-14-8-5-9-15-21/h5-19,24-27,29,34H,20H2,1-4H3/t24?,25?,26-,27?,29+/m1/s1 |
| InChIKey | FWQQXUPVLIQEMA-BSQBKHTQSA-N |
| XLogP | 4.92 |
| TPSA | 113.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.78 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|