C29H33N3O5SSi — CID 10437858
[(3S,4R,5R,6S)-5-azido-2-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-6-methylsulfanyloxan-4-yl] benzoate (PubChem CID 10437858) has the molecular formula C29H33N3O5SSi and a molecular weight of 563.75 g/mol. Its IUPAC name is [(3S,4R,5R,6S)-5-azido-2-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-6-methylsulfanyloxan-4-yl] benzoate.
| Compound Name | [(3S,4R,5R,6S)-5-azido-2-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-6-methylsulfanyloxan-4-yl] benzoate |
|---|---|
| PubChem CID | 10437858 |
| Molecular Formula | C29H33N3O5SSi |
| Molecular Weight | 563.75 g/mol |
| Exact Mass | 563.19 |
| IUPAC Name | [(3S,4R,5R,6S)-5-azido-2-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-6-methylsulfanyloxan-4-yl] benzoate |
| SMILES | CS[C@@H]1OC(O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H](O)[C@H](OC(=O)c2ccccc2)[C@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C29H33N3O5SSi/c1-29(2,3)39(21-16-10-6-11-17-21,22-18-12-7-13-19-22)37-27-24(33)25(23(31-32-30)28(36-27)38-4)35-26(34)20-14-8-5-9-15-20/h5-19,23-25,27-28,33H,1-4H3/t23-,24+,25-,27?,28+/m1/s1 |
| InChIKey | KSUGXGWWAGXXAQ-IIUXATEPSA-N |
| XLogP | 4.87 |
| TPSA | 113.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.75 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|