C13H13N3O5 — CID 10517670
[(1R,2S,3R,4R,5R)-4-azido-2-hydroxy-6,8-dioxabicyclo[3.2.1]octan-3-yl] benzoate (PubChem CID 10517670) has the molecular formula C13H13N3O5 and a molecular weight of 291.26 g/mol. Its IUPAC name is [(1R,2S,3R,4R,5R)-4-azido-2-hydroxy-6,8-dioxabicyclo[3.2.1]octan-3-yl] benzoate.
| Compound Name | [(1R,2S,3R,4R,5R)-4-azido-2-hydroxy-6,8-dioxabicyclo[3.2.1]octan-3-yl] benzoate |
|---|---|
| PubChem CID | 10517670 |
| Molecular Formula | C13H13N3O5 |
| Molecular Weight | 291.26 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | [(1R,2S,3R,4R,5R)-4-azido-2-hydroxy-6,8-dioxabicyclo[3.2.1]octan-3-yl] benzoate |
| SMILES | [N-]=[N+]=N[C@H]1[C@@H]2OC[C@@H](O2)[C@@H](O)[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C13H13N3O5/c14-16-15-9-11(10(17)8-6-19-13(9)20-8)21-12(18)7-4-2-1-3-5-7/h1-5,8-11,13,17H,6H2/t8-,9-,10-,11-,13-/m1/s1 |
| InChIKey | RHBISARZQOXYAZ-VDWIVTDKSA-N |
| XLogP | 1.01 |
| TPSA | 113.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.26 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|