C20H16N4O5 — CID 11417942
[(3S,4R,5R,6R)-4-azido-5-benzoyloxy-6-cyanooxan-3-yl] benzoate (PubChem CID 11417942) has the molecular formula C20H16N4O5 and a molecular weight of 392.37 g/mol. Its IUPAC name is [(3S,4R,5R,6R)-4-azido-5-benzoyloxy-6-cyanooxan-3-yl] benzoate.
| Compound Name | [(3S,4R,5R,6R)-4-azido-5-benzoyloxy-6-cyanooxan-3-yl] benzoate |
|---|---|
| PubChem CID | 11417942 |
| Molecular Formula | C20H16N4O5 |
| Molecular Weight | 392.37 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | [(3S,4R,5R,6R)-4-azido-5-benzoyloxy-6-cyanooxan-3-yl] benzoate |
| SMILES | N#C[C@H]1OC[C@@H](OC(=O)c2ccccc2)[C@@H](N=[N+]=[N-])[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H16N4O5/c21-11-15-18(29-20(26)14-9-5-2-6-10-14)17(23-24-22)16(12-27-15)28-19(25)13-7-3-1-4-8-13/h1-10,15-18H,12H2/t15-,16-,17-,18+/m1/s1 |
| InChIKey | QJXWSSBOCAZXBZ-TVFCKZIOSA-N |
| XLogP | 3.04 |
| TPSA | 134.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.37 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|