C41H48O7S2Si — CID 11343164
[(7S)-8,8-bis(benzenesulfonyl)-7-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]oct-5-ynoxy]-tert-butyl-diphenylsilane (PubChem CID 11343164) has the molecular formula C41H48O7S2Si and a molecular weight of 745.05 g/mol. Its IUPAC name is [(7S)-8,8-bis(benzenesulfonyl)-7-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]oct-5-ynoxy]-tert-butyl-diphenylsilane.
| Compound Name | [(7S)-8,8-bis(benzenesulfonyl)-7-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]oct-5-ynoxy]-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 11343164 |
| Molecular Formula | C41H48O7S2Si |
| Molecular Weight | 745.05 g/mol |
| Exact Mass | 744.26 |
| IUPAC Name | [(7S)-8,8-bis(benzenesulfonyl)-7-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]oct-5-ynoxy]-tert-butyl-diphenylsilane |
| SMILES | CC1(C)OC[C@H]([C@H](C#CCCCCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C(S(=O)(=O)c2ccccc2)S(=O)(=O)c2ccccc2)O1 |
| InChI | InChI=1S/C41H48O7S2Si/c1-40(2,3)51(35-26-16-10-17-27-35,36-28-18-11-19-29-36)47-31-21-7-6-20-30-37(38-32-46-41(4,5)48-38)39(49(42,43)33-22-12-8-13-23-33)50(44,45)34-24-14-9-15-25-34/h8-19,22-29,37-39H,6-7,21,31-32H2,1-5H3/t37-,38+/m0/s1 |
| InChIKey | PRQQJVNCVCDYBQ-QPPIDDCLSA-N |
| XLogP | 6.78 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.05 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|