C28H36O5Si — CID 10672385
ethyl (5S)-5-[tert-butyl(diphenyl)silyl]oxy-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]pent-2-ynoate (PubChem CID 10672385) has the molecular formula C28H36O5Si and a molecular weight of 480.68 g/mol. Its IUPAC name is ethyl (5S)-5-[tert-butyl(diphenyl)silyl]oxy-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]pent-2-ynoate.
| Compound Name | ethyl (5S)-5-[tert-butyl(diphenyl)silyl]oxy-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]pent-2-ynoate |
|---|---|
| PubChem CID | 10672385 |
| Molecular Formula | C28H36O5Si |
| Molecular Weight | 480.68 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | ethyl (5S)-5-[tert-butyl(diphenyl)silyl]oxy-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]pent-2-ynoate |
| SMILES | CCOC(=O)C#CC[C@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C28H36O5Si/c1-7-30-26(29)20-14-19-24(25-21-31-28(5,6)32-25)33-34(27(2,3)4,22-15-10-8-11-16-22)23-17-12-9-13-18-23/h8-13,15-18,24-25H,7,19,21H2,1-6H3/t24-,25+/m0/s1 |
| InChIKey | BGVVJWXQABYEQI-LOSJGSFVSA-N |
| XLogP | 4.04 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.68 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|