C28H40O5Si — CID 11317720
tert-butyl-[(E,1R)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-(methoxymethoxy)-3-methylbut-2-enoxy]-diphenylsilane (PubChem CID 11317720) has the molecular formula C28H40O5Si and a molecular weight of 484.71 g/mol. Its IUPAC name is tert-butyl-[(E,1R)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-(methoxymethoxy)-3-methylbut-2-enoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(E,1R)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-(methoxymethoxy)-3-methylbut-2-enoxy]-diphenylsilane |
|---|---|
| PubChem CID | 11317720 |
| Molecular Formula | C28H40O5Si |
| Molecular Weight | 484.71 g/mol |
| Exact Mass | 484.26 |
| IUPAC Name | tert-butyl-[(E,1R)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-(methoxymethoxy)-3-methylbut-2-enoxy]-diphenylsilane |
| SMILES | COCOC/C(C)=C/[C@@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C28H40O5Si/c1-22(19-30-21-29-7)18-25(26-20-31-28(5,6)32-26)33-34(27(2,3)4,23-14-10-8-11-15-23)24-16-12-9-13-17-24/h8-18,25-26H,19-21H2,1-7H3/b22-18+/t25-,26-/m1/s1 |
| InChIKey | DNEATFZRMNOWTQ-JEBUGFRQSA-N |
| XLogP | 4.65 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.71 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|