C28H38O4Si — CID 53248433
(4S)-4-[tert-butyl(diphenyl)silyl]oxy-4-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]butanal (PubChem CID 53248433) has the molecular formula C28H38O4Si and a molecular weight of 466.69 g/mol. Its IUPAC name is (4S)-4-[tert-butyl(diphenyl)silyl]oxy-4-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]butanal.
| Compound Name | (4S)-4-[tert-butyl(diphenyl)silyl]oxy-4-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]butanal |
|---|---|
| PubChem CID | 53248433 |
| Molecular Formula | C28H38O4Si |
| Molecular Weight | 466.69 g/mol |
| Exact Mass | 466.25 |
| IUPAC Name | (4S)-4-[tert-butyl(diphenyl)silyl]oxy-4-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]butanal |
| SMILES | CC(C)(C)[Si](O[C@@H](CCC=O)[C@H]1COC2(CCCCC2)O1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H38O4Si/c1-27(2,3)33(23-14-7-4-8-15-23,24-16-9-5-10-17-24)32-25(18-13-21-29)26-22-30-28(31-26)19-11-6-12-20-28/h4-5,7-10,14-17,21,25-26H,6,11-13,18-20,22H2,1-3H3/t25-,26+/m0/s1 |
| InChIKey | XIIGYANNGWASJC-IZZNHLLZSA-N |
| XLogP | 4.99 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.69 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|