C29H42O3Si — CID 57041576
tert-butyl-[2-[(4S)-1,5-dioxaspiro[5.5]undecan-4-yl]-2-methylpropoxy]-diphenylsilane (PubChem CID 57041576) has the molecular formula C29H42O3Si and a molecular weight of 466.74 g/mol. Its IUPAC name is tert-butyl-[2-[(4S)-1,5-dioxaspiro[5.5]undecan-4-yl]-2-methylpropoxy]-diphenylsilane.
| Compound Name | tert-butyl-[2-[(4S)-1,5-dioxaspiro[5.5]undecan-4-yl]-2-methylpropoxy]-diphenylsilane |
|---|---|
| PubChem CID | 57041576 |
| Molecular Formula | C29H42O3Si |
| Molecular Weight | 466.74 g/mol |
| Exact Mass | 466.29 |
| IUPAC Name | tert-butyl-[2-[(4S)-1,5-dioxaspiro[5.5]undecan-4-yl]-2-methylpropoxy]-diphenylsilane |
| SMILES | CC(C)(CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@@H]1CCOC2(CCCCC2)O1 |
| InChI | InChI=1S/C29H42O3Si/c1-27(2,3)33(24-15-9-6-10-16-24,25-17-11-7-12-18-25)31-23-28(4,5)26-19-22-30-29(32-26)20-13-8-14-21-29/h6-7,9-12,15-18,26H,8,13-14,19-23H2,1-5H3/t26-/m0/s1 |
| InChIKey | OHASOTNFLZXAAW-SANMLTNESA-N |
| XLogP | 6.06 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.74 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|