C28H38O3Si — CID 11597593
tert-butyl-[(1R)-1-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]but-3-enoxy]-diphenylsilane (PubChem CID 11597593) has the molecular formula C28H38O3Si and a molecular weight of 450.70 g/mol. Its IUPAC name is tert-butyl-[(1R)-1-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]but-3-enoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(1R)-1-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]but-3-enoxy]-diphenylsilane |
|---|---|
| PubChem CID | 11597593 |
| Molecular Formula | C28H38O3Si |
| Molecular Weight | 450.70 g/mol |
| Exact Mass | 450.26 |
| IUPAC Name | tert-butyl-[(1R)-1-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]but-3-enoxy]-diphenylsilane |
| SMILES | C=CC[C@@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H]1COC2(CCCCC2)O1 |
| InChI | InChI=1S/C28H38O3Si/c1-5-15-25(26-22-29-28(30-26)20-13-8-14-21-28)31-32(27(2,3)4,23-16-9-6-10-17-23)24-18-11-7-12-19-24/h5-7,9-12,16-19,25-26H,1,8,13-15,20-22H2,2-4H3/t25-,26-/m1/s1 |
| InChIKey | BRPIZZSXGOILIZ-CLJLJLNGSA-N |
| XLogP | 5.58 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.70 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|