C27H34O5Si — CID 25227816
(3aS,6S,6aS)-6-[(1S)-1-[tert-butyl(diphenyl)silyl]oxybut-3-enyl]-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-one (PubChem CID 25227816) has the molecular formula C27H34O5Si and a molecular weight of 466.65 g/mol. Its IUPAC name is (3aS,6S,6aS)-6-[(1S)-1-[tert-butyl(diphenyl)silyl]oxybut-3-enyl]-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-one.
| Compound Name | (3aS,6S,6aS)-6-[(1S)-1-[tert-butyl(diphenyl)silyl]oxybut-3-enyl]-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-one |
|---|---|
| PubChem CID | 25227816 |
| Molecular Formula | C27H34O5Si |
| Molecular Weight | 466.65 g/mol |
| Exact Mass | 466.22 |
| IUPAC Name | (3aS,6S,6aS)-6-[(1S)-1-[tert-butyl(diphenyl)silyl]oxybut-3-enyl]-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-one |
| SMILES | C=CC[C@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H]1OC(=O)[C@H]2OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C27H34O5Si/c1-7-14-21(22-23-24(25(28)29-22)31-27(5,6)30-23)32-33(26(2,3)4,19-15-10-8-11-16-19)20-17-12-9-13-18-20/h7-13,15-18,21-24H,1,14H2,2-6H3/t21-,22+,23-,24-/m0/s1 |
| InChIKey | ZWTRXGYMAFLJMX-KIHHCIJBSA-N |
| XLogP | 3.95 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.65 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|